C21H23N3O3S — CID 8655688
4-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]-N-(4-methylphenyl)piperazine-1-carbothioamide (PubChem CID 8655688) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 4-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]-N-(4-methylphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]-N-(4-methylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8655688 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 4-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]-N-(4-methylphenyl)piperazine-1-carbothioamide |
| SMILES | Cc1ccc(NC(=S)N2CCN(C(=O)[C@@H]3COc4ccccc4O3)CC2)cc1 |
| InChI | InChI=1S/C21H23N3O3S/c1-15-6-8-16(9-7-15)22-21(28)24-12-10-23(11-13-24)20(25)19-14-26-17-4-2-3-5-18(17)27-19/h2-9,19H,10-14H2,1H3,(H,22,28)/t19-/m0/s1 |
| InChIKey | QIBOCNNLMJEAAJ-IBGZPJMESA-N |
| XLogP | 2.68 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|