C10H20N2O3S3 — CID 116509286
3-ethylsulfonyl-N-(2-methoxyethyl)thiomorpholine-4-carbothioamide (PubChem CID 116509286) has the molecular formula C10H20N2O3S3 and a molecular weight of 312.48 g/mol. Its IUPAC name is 3-ethylsulfonyl-N-(2-methoxyethyl)thiomorpholine-4-carbothioamide.
| Compound Name | 3-ethylsulfonyl-N-(2-methoxyethyl)thiomorpholine-4-carbothioamide |
|---|---|
| PubChem CID | 116509286 |
| Molecular Formula | C10H20N2O3S3 |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 3-ethylsulfonyl-N-(2-methoxyethyl)thiomorpholine-4-carbothioamide |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=S)NCCOC |
| InChI | InChI=1S/C10H20N2O3S3/c1-3-18(13,14)9-8-17-7-5-12(9)10(16)11-4-6-15-2/h9H,3-8H2,1-2H3,(H,11,16) |
| InChIKey | HDFJLWPLKRPDID-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|