About 2-hydroxyethyl 3-ethylsulfonylthiomorpholine-4-carboxylate
2-hydroxyethyl 3-ethylsulfonylthiomorpholine-4-carboxylate (PubChem CID 79348567) has the molecular formula C9H17NO5S2
and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-hydroxyethyl 3-ethylsulfonylthiomorpholine-4-carboxylate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 3-ethylsulfonylthiomorpholine-4-carboxylate |
| PubChem CID | 79348567 |
| Molecular Formula | C9H17NO5S2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-hydroxyethyl 3-ethylsulfonylthiomorpholine-4-carboxylate |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)OCCO |
| InChI | InChI=1S/C9H17NO5S2/c1-2-17(13,14)8-7-16-6-3-10(8)9(12)15-5-4-11/h8,11H,2-7H2,1H3 |
| InChIKey | OSPPDOZZJRKKPE-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-hydroxyethyl 3-ethylsulfonylthiomorpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 3-ethylsulfonylthiomorpholine-4-carboxylate?
The IUPAC name of 2-hydroxyethyl 3-ethylsulfonylthiomorpholine-4-carboxylate (CID 79348567) is 2-hydroxyethyl 3-ethylsulfonylthiomorpholine-4-carboxylate.
What is the SMILES notation for 2-hydroxyethyl 3-ethylsulfonylthiomorpholine-4-carboxylate?
The canonical SMILES for 2-hydroxyethyl 3-ethylsulfonylthiomorpholine-4-carboxylate is CCS(=O)(=O)C1CSCCN1C(=O)OCCO.
What is the InChIKey of 2-hydroxyethyl 3-ethylsulfonylthiomorpholine-4-carboxylate?
The InChIKey is OSPPDOZZJRKKPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO5S2/c1-2-17(13,14)8-7-16-6-3-10(8)9(12)15-5-4-11/h8,11H,2-7H2,1H3.
What are the key properties of 2-hydroxyethyl 3-ethylsulfonylthiomorpholine-4-carboxylate?
2-hydroxyethyl 3-ethylsulfonylthiomorpholine-4-carboxylate has a molecular weight of 283.37 g/mol, XLogP of -0.08, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 3-ethylsulfonylthiomorpholine-4-carboxylate is sourced from PubChem (CID 79348567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).