C9H17NO5S2 — CID 79348567
2-hydroxyethyl 3-ethylsulfonylthiomorpholine-4-carboxylate (PubChem CID 79348567) has the molecular formula C9H17NO5S2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-hydroxyethyl 3-ethylsulfonylthiomorpholine-4-carboxylate.
| Compound Name | 2-hydroxyethyl 3-ethylsulfonylthiomorpholine-4-carboxylate |
|---|---|
| PubChem CID | 79348567 |
| Molecular Formula | C9H17NO5S2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-hydroxyethyl 3-ethylsulfonylthiomorpholine-4-carboxylate |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)OCCO |
| InChI | InChI=1S/C9H17NO5S2/c1-2-17(13,14)8-7-16-6-3-10(8)9(12)15-5-4-11/h8,11H,2-7H2,1H3 |
| InChIKey | OSPPDOZZJRKKPE-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |