C11H20ClNO3S2 — CID 66376553
3-chloro-1-(3-ethylsulfonylthiomorpholin-4-yl)-2,2-dimethylpropan-1-one (PubChem CID 66376553) has the molecular formula C11H20ClNO3S2 and a molecular weight of 313.87 g/mol. Its IUPAC name is 3-chloro-1-(3-ethylsulfonylthiomorpholin-4-yl)-2,2-dimethylpropan-1-one.
| Compound Name | 3-chloro-1-(3-ethylsulfonylthiomorpholin-4-yl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 66376553 |
| Molecular Formula | C11H20ClNO3S2 |
| Molecular Weight | 313.87 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 3-chloro-1-(3-ethylsulfonylthiomorpholin-4-yl)-2,2-dimethylpropan-1-one |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C11H20ClNO3S2/c1-4-18(15,16)9-7-17-6-5-13(9)10(14)11(2,3)8-12/h9H,4-8H2,1-3H3 |
| InChIKey | AJGSKLXOUGBZMZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.87 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|