C13H24N2O3S2 — CID 66375815
[2-(aminomethyl)cyclopentyl]-(3-ethylsulfonylthiomorpholin-4-yl)methanone (PubChem CID 66375815) has the molecular formula C13H24N2O3S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is [2-(aminomethyl)cyclopentyl]-(3-ethylsulfonylthiomorpholin-4-yl)methanone.
| Compound Name | [2-(aminomethyl)cyclopentyl]-(3-ethylsulfonylthiomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 66375815 |
| Molecular Formula | C13H24N2O3S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | [2-(aminomethyl)cyclopentyl]-(3-ethylsulfonylthiomorpholin-4-yl)methanone |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)C1CCCC1CN |
| InChI | InChI=1S/C13H24N2O3S2/c1-2-20(17,18)12-9-19-7-6-15(12)13(16)11-5-3-4-10(11)8-14/h10-12H,2-9,14H2,1H3 |
| InChIKey | NVAVXKORFDXUFP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |