C14H24N2O3S2 — CID 102893294
1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl-(3-ethylsulfonylthiomorpholin-4-yl)methanone (PubChem CID 102893294) has the molecular formula C14H24N2O3S2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl-(3-ethylsulfonylthiomorpholin-4-yl)methanone.
| Compound Name | 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl-(3-ethylsulfonylthiomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 102893294 |
| Molecular Formula | C14H24N2O3S2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl-(3-ethylsulfonylthiomorpholin-4-yl)methanone |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)C1NCC2CCCC21 |
| InChI | InChI=1S/C14H24N2O3S2/c1-2-21(18,19)12-9-20-7-6-16(12)14(17)13-11-5-3-4-10(11)8-15-13/h10-13,15H,2-9H2,1H3 |
| InChIKey | CLGPCJGALPTDJQ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |