C12H20N2O5S2 — CID 66377773
(2R)-1-(3-ethylsulfonylthiomorpholine-4-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 66377773) has the molecular formula C12H20N2O5S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is (2R)-1-(3-ethylsulfonylthiomorpholine-4-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-(3-ethylsulfonylthiomorpholine-4-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 66377773 |
| Molecular Formula | C12H20N2O5S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | (2R)-1-(3-ethylsulfonylthiomorpholine-4-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)N1CCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C12H20N2O5S2/c1-2-21(18,19)10-8-20-7-6-14(10)12(17)13-5-3-4-9(13)11(15)16/h9-10H,2-8H2,1H3,(H,15,16)/t9-,10?/m1/s1 |
| InChIKey | YKIQENWAILTZRU-YHMJZVADSA-N |
| XLogP | 0.47 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |