C13H20N2O5S — CID 82902421
4-(2-ethoxycarbonylpyrrolidine-1-carbonyl)thiomorpholine-3-carboxylic acid (PubChem CID 82902421) has the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. Its IUPAC name is 4-(2-ethoxycarbonylpyrrolidine-1-carbonyl)thiomorpholine-3-carboxylic acid.
| Compound Name | 4-(2-ethoxycarbonylpyrrolidine-1-carbonyl)thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82902421 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 4-(2-ethoxycarbonylpyrrolidine-1-carbonyl)thiomorpholine-3-carboxylic acid |
| SMILES | CCOC(=O)C1CCCN1C(=O)N1CCSCC1C(=O)O |
| InChI | InChI=1S/C13H20N2O5S/c1-2-20-12(18)9-4-3-5-14(9)13(19)15-6-7-21-8-10(15)11(16)17/h9-10H,2-8H2,1H3,(H,16,17) |
| InChIKey | DGXVESAIBZTDOW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |