C13H22N2O3S — CID 104913277
ethyl 4-[(2R)-piperidine-2-carbonyl]thiomorpholine-3-carboxylate (PubChem CID 104913277) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is ethyl 4-[(2R)-piperidine-2-carbonyl]thiomorpholine-3-carboxylate.
| Compound Name | ethyl 4-[(2R)-piperidine-2-carbonyl]thiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 104913277 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | ethyl 4-[(2R)-piperidine-2-carbonyl]thiomorpholine-3-carboxylate |
| SMILES | CCOC(=O)C1CSCCN1C(=O)[C@H]1CCCCN1 |
| InChI | InChI=1S/C13H22N2O3S/c1-2-18-13(17)11-9-19-8-7-15(11)12(16)10-5-3-4-6-14-10/h10-11,14H,2-9H2,1H3/t10-,11?/m1/s1 |
| InChIKey | ASYLIIBWKBHJKR-NFJWQWPMSA-N |
| XLogP | 0.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |