C12H19NO5S2 — CID 77135692
4-(3-ethylsulfonylthiomorpholin-4-yl)-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 77135692) has the molecular formula C12H19NO5S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-(3-ethylsulfonylthiomorpholin-4-yl)-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | 4-(3-ethylsulfonylthiomorpholin-4-yl)-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 77135692 |
| Molecular Formula | C12H19NO5S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 4-(3-ethylsulfonylthiomorpholin-4-yl)-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)C(C)=C(C)C(=O)O |
| InChI | InChI=1S/C12H19NO5S2/c1-4-20(17,18)10-7-19-6-5-13(10)11(14)8(2)9(3)12(15)16/h10H,4-7H2,1-3H3,(H,15,16) |
| InChIKey | NLMVDCVGWPMFRZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|