C11H22N2O3S3 — CID 116509285
3-ethylsulfonyl-N-(1-methoxypropan-2-yl)thiomorpholine-4-carbothioamide (PubChem CID 116509285) has the molecular formula C11H22N2O3S3 and a molecular weight of 326.51 g/mol. Its IUPAC name is 3-ethylsulfonyl-N-(1-methoxypropan-2-yl)thiomorpholine-4-carbothioamide.
| Compound Name | 3-ethylsulfonyl-N-(1-methoxypropan-2-yl)thiomorpholine-4-carbothioamide |
|---|---|
| PubChem CID | 116509285 |
| Molecular Formula | C11H22N2O3S3 |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 3-ethylsulfonyl-N-(1-methoxypropan-2-yl)thiomorpholine-4-carbothioamide |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=S)NC(C)COC |
| InChI | InChI=1S/C11H22N2O3S3/c1-4-19(14,15)10-8-18-6-5-13(10)11(17)12-9(2)7-16-3/h9-10H,4-8H2,1-3H3,(H,12,17) |
| InChIKey | ZWAMESYSFWSCBI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|