C20H29N5OS — CID 19291616
4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-(2-methoxyethyl)piperazine-1-carbothioamide (PubChem CID 19291616) has the molecular formula C20H29N5OS and a molecular weight of 387.55 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-(2-methoxyethyl)piperazine-1-carbothioamide.
| Compound Name | 4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-(2-methoxyethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19291616 |
| Molecular Formula | C20H29N5OS |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-(2-methoxyethyl)piperazine-1-carbothioamide |
| SMILES | COCCNC(=S)N1CCN(Cc2c(C)nn(-c3ccccc3)c2C)CC1 |
| InChI | InChI=1S/C20H29N5OS/c1-16-19(17(2)25(22-16)18-7-5-4-6-8-18)15-23-10-12-24(13-11-23)20(27)21-9-14-26-3/h4-8H,9-15H2,1-3H3,(H,21,27) |
| InChIKey | WBPGDZHRPOZVKL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|