C20H22F3N3OS — CID 19574372
N-[2-(difluoromethoxy)-5-methylphenyl]-4-[(3-fluorophenyl)methyl]piperazine-1-carbothioamide (PubChem CID 19574372) has the molecular formula C20H22F3N3OS and a molecular weight of 409.48 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)-5-methylphenyl]-4-[(3-fluorophenyl)methyl]piperazine-1-carbothioamide.
| Compound Name | N-[2-(difluoromethoxy)-5-methylphenyl]-4-[(3-fluorophenyl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19574372 |
| Molecular Formula | C20H22F3N3OS |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-[2-(difluoromethoxy)-5-methylphenyl]-4-[(3-fluorophenyl)methyl]piperazine-1-carbothioamide |
| SMILES | Cc1ccc(OC(F)F)c(NC(=S)N2CCN(Cc3cccc(F)c3)CC2)c1 |
| InChI | InChI=1S/C20H22F3N3OS/c1-14-5-6-18(27-19(22)23)17(11-14)24-20(28)26-9-7-25(8-10-26)13-15-3-2-4-16(21)12-15/h2-6,11-12,19H,7-10,13H2,1H3,(H,24,28) |
| InChIKey | OGKSKKWCYWMWAE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|