C13H19F3N4O2 — CID 19449764
1-cyclohexyl-3-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]urea (PubChem CID 19449764) has the molecular formula C13H19F3N4O2 and a molecular weight of 320.32 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]urea.
| Compound Name | 1-cyclohexyl-3-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 19449764 |
| Molecular Formula | C13H19F3N4O2 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-cyclohexyl-3-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]urea |
| SMILES | O=C(Nc1cnn(COCC(F)(F)F)c1)NC1CCCCC1 |
| InChI | InChI=1S/C13H19F3N4O2/c14-13(15,16)8-22-9-20-7-11(6-17-20)19-12(21)18-10-4-2-1-3-5-10/h6-7,10H,1-5,8-9H2,(H2,18,19,21) |
| InChIKey | KCKQDHMVZUBXFG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |