C13H11F4N3O2 — CID 19340739
3-fluoro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzamide (PubChem CID 19340739) has the molecular formula C13H11F4N3O2 and a molecular weight of 317.24 g/mol. Its IUPAC name is 3-fluoro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzamide.
| Compound Name | 3-fluoro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 19340739 |
| Molecular Formula | C13H11F4N3O2 |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 3-fluoro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzamide |
| SMILES | O=C(Nc1cnn(COCC(F)(F)F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C13H11F4N3O2/c14-10-3-1-2-9(4-10)12(21)19-11-5-18-20(6-11)8-22-7-13(15,16)17/h1-6H,7-8H2,(H,19,21) |
| InChIKey | LBFDXNHOVGKYMD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |