C13H10F3N5O6 — CID 19340710
3,5-dinitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzamide (PubChem CID 19340710) has the molecular formula C13H10F3N5O6 and a molecular weight of 389.25 g/mol. Its IUPAC name is 3,5-dinitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzamide.
| Compound Name | 3,5-dinitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 19340710 |
| Molecular Formula | C13H10F3N5O6 |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 3,5-dinitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzamide |
| SMILES | O=C(Nc1cnn(COCC(F)(F)F)c1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10F3N5O6/c14-13(15,16)6-27-7-19-5-9(4-17-19)18-12(22)8-1-10(20(23)24)3-11(2-8)21(25)26/h1-5H,6-7H2,(H,18,22) |
| InChIKey | VEGIJAAUODCBHT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 142.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|