About 4-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzenesulfonamide
4-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzenesulfonamide (PubChem CID 19581868) has the molecular formula C12H11F3N4O5S
and a molecular weight of 380.30 g/mol. Its IUPAC name is 4-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzenesulfonamide |
| PubChem CID | 19581868 |
| Molecular Formula | C12H11F3N4O5S |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 4-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)Nc2cnn(COCC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C12H11F3N4O5S/c13-12(14,15)7-24-8-18-6-9(5-16-18)17-25(22,23)11-3-1-10(2-4-11)19(20)21/h1-6,17H,7-8H2 |
| InChIKey | SLWUTXXXQDOUNA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzenesulfonamide?
The IUPAC name of 4-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzenesulfonamide (CID 19581868) is 4-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzenesulfonamide.
What is the SMILES notation for 4-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzenesulfonamide?
The canonical SMILES for 4-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzenesulfonamide is O=[N+]([O-])c1ccc(S(=O)(=O)Nc2cnn(COCC(F)(F)F)c2)cc1.
What is the InChIKey of 4-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzenesulfonamide?
The InChIKey is SLWUTXXXQDOUNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3N4O5S/c13-12(14,15)7-24-8-18-6-9(5-16-18)17-25(22,23)11-3-1-10(2-4-11)19(20)21/h1-6,17H,7-8H2.
What are the key properties of 4-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzenesulfonamide?
4-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzenesulfonamide has a molecular weight of 380.30 g/mol, XLogP of 2.13, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzenesulfonamide is sourced from PubChem (CID 19581868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).