C14H13F3N4O5 — CID 19340733
4-methoxy-3-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzamide (PubChem CID 19340733) has the molecular formula C14H13F3N4O5 and a molecular weight of 374.28 g/mol. Its IUPAC name is 4-methoxy-3-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzamide.
| Compound Name | 4-methoxy-3-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 19340733 |
| Molecular Formula | C14H13F3N4O5 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 4-methoxy-3-nitro-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2cnn(COCC(F)(F)F)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13F3N4O5/c1-25-12-3-2-9(4-11(12)21(23)24)13(22)19-10-5-18-20(6-10)8-26-7-14(15,16)17/h2-6H,7-8H2,1H3,(H,19,22) |
| InChIKey | AEAKGQYDLBFICY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|