C17H20Cl2N4O — CID 35592061
1-cyclohexyl-3-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]urea (PubChem CID 35592061) has the molecular formula C17H20Cl2N4O and a molecular weight of 367.28 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]urea.
| Compound Name | 1-cyclohexyl-3-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 35592061 |
| Molecular Formula | C17H20Cl2N4O |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 1-cyclohexyl-3-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]urea |
| SMILES | O=C(Nc1cnn(Cc2ccc(Cl)cc2Cl)c1)NC1CCCCC1 |
| InChI | InChI=1S/C17H20Cl2N4O/c18-13-7-6-12(16(19)8-13)10-23-11-15(9-20-23)22-17(24)21-14-4-2-1-3-5-14/h6-9,11,14H,1-5,10H2,(H2,21,22,24) |
| InChIKey | VIQKMWXBHLJCNE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |