C17H20ClFN4O2 — CID 39854205
1-[1-[(2-chloro-4-fluorophenoxy)methyl]pyrazol-4-yl]-3-cyclohexylurea (PubChem CID 39854205) has the molecular formula C17H20ClFN4O2 and a molecular weight of 366.82 g/mol. Its IUPAC name is 1-[1-[(2-chloro-4-fluorophenoxy)methyl]pyrazol-4-yl]-3-cyclohexylurea.
| Compound Name | 1-[1-[(2-chloro-4-fluorophenoxy)methyl]pyrazol-4-yl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 39854205 |
| Molecular Formula | C17H20ClFN4O2 |
| Molecular Weight | 366.82 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 1-[1-[(2-chloro-4-fluorophenoxy)methyl]pyrazol-4-yl]-3-cyclohexylurea |
| SMILES | O=C(Nc1cnn(COc2ccc(F)cc2Cl)c1)NC1CCCCC1 |
| InChI | InChI=1S/C17H20ClFN4O2/c18-15-8-12(19)6-7-16(15)25-11-23-10-14(9-20-23)22-17(24)21-13-4-2-1-3-5-13/h6-10,13H,1-5,11H2,(H2,21,22,24) |
| InChIKey | STAAINSUZDJSTM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.82 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |