C15H11ClFN3O2S — CID 39853967
N-[1-[(2-chloro-4-fluorophenoxy)methyl]pyrazol-4-yl]thiophene-2-carboxamide (PubChem CID 39853967) has the molecular formula C15H11ClFN3O2S and a molecular weight of 351.79 g/mol. Its IUPAC name is N-[1-[(2-chloro-4-fluorophenoxy)methyl]pyrazol-4-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-[(2-chloro-4-fluorophenoxy)methyl]pyrazol-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 39853967 |
| Molecular Formula | C15H11ClFN3O2S |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | N-[1-[(2-chloro-4-fluorophenoxy)methyl]pyrazol-4-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cnn(COc2ccc(F)cc2Cl)c1)c1cccs1 |
| InChI | InChI=1S/C15H11ClFN3O2S/c16-12-6-10(17)3-4-13(12)22-9-20-8-11(7-18-20)19-15(21)14-2-1-5-23-14/h1-8H,9H2,(H,19,21) |
| InChIKey | NHDCGOGBXHIJKA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |