C17H13Cl2FN4O2 — CID 35592335
1-[1-[(2-chloro-4-fluorophenoxy)methyl]pyrazol-4-yl]-3-(2-chlorophenyl)urea (PubChem CID 35592335) has the molecular formula C17H13Cl2FN4O2 and a molecular weight of 395.22 g/mol. Its IUPAC name is 1-[1-[(2-chloro-4-fluorophenoxy)methyl]pyrazol-4-yl]-3-(2-chlorophenyl)urea.
| Compound Name | 1-[1-[(2-chloro-4-fluorophenoxy)methyl]pyrazol-4-yl]-3-(2-chlorophenyl)urea |
|---|---|
| PubChem CID | 35592335 |
| Molecular Formula | C17H13Cl2FN4O2 |
| Molecular Weight | 395.22 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 1-[1-[(2-chloro-4-fluorophenoxy)methyl]pyrazol-4-yl]-3-(2-chlorophenyl)urea |
| SMILES | O=C(Nc1cnn(COc2ccc(F)cc2Cl)c1)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H13Cl2FN4O2/c18-13-3-1-2-4-15(13)23-17(25)22-12-8-21-24(9-12)10-26-16-6-5-11(20)7-14(16)19/h1-9H,10H2,(H2,22,23,25) |
| InChIKey | CMRLHDNIDMXEED-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.22 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |