C18H19F3N6OS — CID 19446013
1-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]-3-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]thiourea (PubChem CID 19446013) has the molecular formula C18H19F3N6OS and a molecular weight of 424.45 g/mol. Its IUPAC name is 1-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]-3-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]thiourea.
| Compound Name | 1-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]-3-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19446013 |
| Molecular Formula | C18H19F3N6OS |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 1-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]-3-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]thiourea |
| SMILES | Cc1ccccc1Cn1ccc(NC(=S)Nc2cnn(COCC(F)(F)F)c2)n1 |
| InChI | InChI=1S/C18H19F3N6OS/c1-13-4-2-3-5-14(13)9-26-7-6-16(25-26)24-17(29)23-15-8-22-27(10-15)12-28-11-18(19,20)21/h2-8,10H,9,11-12H2,1H3,(H2,23,24,25,29) |
| InChIKey | TWCDVLVHVXJQNS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|