C13H21N3O2S — CID 115687471
1-(3-ethoxypropyl)-3-(6-ethoxy-3-pyridinyl)thiourea (PubChem CID 115687471) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-(6-ethoxy-3-pyridinyl)thiourea.
| Compound Name | 1-(3-ethoxypropyl)-3-(6-ethoxy-3-pyridinyl)thiourea |
|---|---|
| PubChem CID | 115687471 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-(6-ethoxy-3-pyridinyl)thiourea |
| SMILES | CCOCCCNC(=S)Nc1ccc(OCC)nc1 |
| InChI | InChI=1S/C13H21N3O2S/c1-3-17-9-5-8-14-13(19)16-11-6-7-12(15-10-11)18-4-2/h6-7,10H,3-5,8-9H2,1-2H3,(H2,14,16,19) |
| InChIKey | KWSPGYHEMJHGPX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|