C9H16N4S — CID 115590289
1-propyl-3-(2-pyrazol-1-ylethyl)thiourea (PubChem CID 115590289) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is 1-propyl-3-(2-pyrazol-1-ylethyl)thiourea.
| Compound Name | 1-propyl-3-(2-pyrazol-1-ylethyl)thiourea |
|---|---|
| PubChem CID | 115590289 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1-propyl-3-(2-pyrazol-1-ylethyl)thiourea |
| SMILES | CCCNC(=S)NCCn1cccn1 |
| InChI | InChI=1S/C9H16N4S/c1-2-4-10-9(14)11-6-8-13-7-3-5-12-13/h3,5,7H,2,4,6,8H2,1H3,(H2,10,11,14) |
| InChIKey | WRWMBFKSGLHLAG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|