C10H18N4O — CID 115629319
1,1-diethyl-3-(2-pyrazol-1-ylethyl)urea (PubChem CID 115629319) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 1,1-diethyl-3-(2-pyrazol-1-ylethyl)urea.
| Compound Name | 1,1-diethyl-3-(2-pyrazol-1-ylethyl)urea |
|---|---|
| PubChem CID | 115629319 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 1,1-diethyl-3-(2-pyrazol-1-ylethyl)urea |
| SMILES | CCN(CC)C(=O)NCCn1cccn1 |
| InChI | InChI=1S/C10H18N4O/c1-3-13(4-2)10(15)11-7-9-14-8-5-6-12-14/h5-6,8H,3-4,7,9H2,1-2H3,(H,11,15) |
| InChIKey | ZSDCAELGAOHPLN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |