C11H19N3O — CID 103731722
1,1-diethyl-3-(2-pyrrol-1-ylethyl)urea (PubChem CID 103731722) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 1,1-diethyl-3-(2-pyrrol-1-ylethyl)urea.
| Compound Name | 1,1-diethyl-3-(2-pyrrol-1-ylethyl)urea |
|---|---|
| PubChem CID | 103731722 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 1,1-diethyl-3-(2-pyrrol-1-ylethyl)urea |
| SMILES | CCN(CC)C(=O)NCCn1cccc1 |
| InChI | InChI=1S/C11H19N3O/c1-3-14(4-2)11(15)12-7-10-13-8-5-6-9-13/h5-6,8-9H,3-4,7,10H2,1-2H3,(H,12,15) |
| InChIKey | AULYEFLGIMUUCI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |