C15H23N5O3 — CID 154909219
1-ethyl-1-[(1-methylimidazol-2-yl)methyl]-3-(2-pyrrol-1-ylethyl)urea;formic acid (PubChem CID 154909219) has the molecular formula C15H23N5O3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-ethyl-1-[(1-methylimidazol-2-yl)methyl]-3-(2-pyrrol-1-ylethyl)urea;formic acid.
| Compound Name | 1-ethyl-1-[(1-methylimidazol-2-yl)methyl]-3-(2-pyrrol-1-ylethyl)urea;formic acid |
|---|---|
| PubChem CID | 154909219 |
| Molecular Formula | C15H23N5O3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 1-ethyl-1-[(1-methylimidazol-2-yl)methyl]-3-(2-pyrrol-1-ylethyl)urea;formic acid |
| SMILES | CCN(Cc1nccn1C)C(=O)NCCn1cccc1.O=CO |
| InChI | InChI=1S/C14H21N5O.CH2O2/c1-3-19(12-13-15-6-10-17(13)2)14(20)16-7-11-18-8-4-5-9-18;2-1-3/h4-6,8-10H,3,7,11-12H2,1-2H3,(H,16,20);1H,(H,2,3) |
| InChIKey | LTVJRJYRIWVQRU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 92.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|