C15H19FN4O — CID 118766238
1-ethyl-3-(4-fluoro-3-methylphenyl)-1-[(1-methylimidazol-2-yl)methyl]urea (PubChem CID 118766238) has the molecular formula C15H19FN4O and a molecular weight of 290.34 g/mol. Its IUPAC name is 1-ethyl-3-(4-fluoro-3-methylphenyl)-1-[(1-methylimidazol-2-yl)methyl]urea.
| Compound Name | 1-ethyl-3-(4-fluoro-3-methylphenyl)-1-[(1-methylimidazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 118766238 |
| Molecular Formula | C15H19FN4O |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-ethyl-3-(4-fluoro-3-methylphenyl)-1-[(1-methylimidazol-2-yl)methyl]urea |
| SMILES | CCN(Cc1nccn1C)C(=O)Nc1ccc(F)c(C)c1 |
| InChI | InChI=1S/C15H19FN4O/c1-4-20(10-14-17-7-8-19(14)3)15(21)18-12-5-6-13(16)11(2)9-12/h5-9H,4,10H2,1-3H3,(H,18,21) |
| InChIKey | RTTAKTNBGNNZTM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |