C17H24N4O3S — CID 72862791
1-[(1-methylimidazol-2-yl)methyl]-3-(2-methyl-5-methylsulfonylphenyl)-1-propylurea (PubChem CID 72862791) has the molecular formula C17H24N4O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is 1-[(1-methylimidazol-2-yl)methyl]-3-(2-methyl-5-methylsulfonylphenyl)-1-propylurea.
| Compound Name | 1-[(1-methylimidazol-2-yl)methyl]-3-(2-methyl-5-methylsulfonylphenyl)-1-propylurea |
|---|---|
| PubChem CID | 72862791 |
| Molecular Formula | C17H24N4O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1-[(1-methylimidazol-2-yl)methyl]-3-(2-methyl-5-methylsulfonylphenyl)-1-propylurea |
| SMILES | CCCN(Cc1nccn1C)C(=O)Nc1cc(S(C)(=O)=O)ccc1C |
| InChI | InChI=1S/C17H24N4O3S/c1-5-9-21(12-16-18-8-10-20(16)3)17(22)19-15-11-14(25(4,23)24)7-6-13(15)2/h6-8,10-11H,5,9,12H2,1-4H3,(H,19,22) |
| InChIKey | YVCIGCPNPNMQNN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |