C22H27N5O — CID 72878655
1-[(1-methylimidazol-2-yl)methyl]-1-propyl-3-[2-(2-pyridin-2-ylethyl)phenyl]urea (PubChem CID 72878655) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-[(1-methylimidazol-2-yl)methyl]-1-propyl-3-[2-(2-pyridin-2-ylethyl)phenyl]urea.
| Compound Name | 1-[(1-methylimidazol-2-yl)methyl]-1-propyl-3-[2-(2-pyridin-2-ylethyl)phenyl]urea |
|---|---|
| PubChem CID | 72878655 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 1-[(1-methylimidazol-2-yl)methyl]-1-propyl-3-[2-(2-pyridin-2-ylethyl)phenyl]urea |
| SMILES | CCCN(Cc1nccn1C)C(=O)Nc1ccccc1CCc1ccccn1 |
| InChI | InChI=1S/C22H27N5O/c1-3-15-27(17-21-24-14-16-26(21)2)22(28)25-20-10-5-4-8-18(20)11-12-19-9-6-7-13-23-19/h4-10,13-14,16H,3,11-12,15,17H2,1-2H3,(H,25,28) |
| InChIKey | DODQUGYCJJJNLC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |