C14H22N2O — CID 113233204
1,1-diethyl-3-(2-propylphenyl)urea (PubChem CID 113233204) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 1,1-diethyl-3-(2-propylphenyl)urea.
| Compound Name | 1,1-diethyl-3-(2-propylphenyl)urea |
|---|---|
| PubChem CID | 113233204 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 1,1-diethyl-3-(2-propylphenyl)urea |
| SMILES | CCCc1ccccc1NC(=O)N(CC)CC |
| InChI | InChI=1S/C14H22N2O/c1-4-9-12-10-7-8-11-13(12)15-14(17)16(5-2)6-3/h7-8,10-11H,4-6,9H2,1-3H3,(H,15,17) |
| InChIKey | FLFZLKJAZQBHDR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |