C12H15F3N2O — CID 115583957
1-(2-propylphenyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 115583957) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is 1-(2-propylphenyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(2-propylphenyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 115583957 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 1-(2-propylphenyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CCCc1ccccc1NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O/c1-2-5-9-6-3-4-7-10(9)17-11(18)16-8-12(13,14)15/h3-4,6-7H,2,5,8H2,1H3,(H2,16,17,18) |
| InChIKey | UEBYLYOZRINMJJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |