C15H20ClN5O — CID 72916605
3-(6-chloro-2-methyl-3-pyridinyl)-1-[(1-methylimidazol-2-yl)methyl]-1-propylurea (PubChem CID 72916605) has the molecular formula C15H20ClN5O and a molecular weight of 321.81 g/mol. Its IUPAC name is 3-(6-chloro-2-methyl-3-pyridinyl)-1-[(1-methylimidazol-2-yl)methyl]-1-propylurea.
| Compound Name | 3-(6-chloro-2-methyl-3-pyridinyl)-1-[(1-methylimidazol-2-yl)methyl]-1-propylurea |
|---|---|
| PubChem CID | 72916605 |
| Molecular Formula | C15H20ClN5O |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 3-(6-chloro-2-methyl-3-pyridinyl)-1-[(1-methylimidazol-2-yl)methyl]-1-propylurea |
| SMILES | CCCN(Cc1nccn1C)C(=O)Nc1ccc(Cl)nc1C |
| InChI | InChI=1S/C15H20ClN5O/c1-4-8-21(10-14-17-7-9-20(14)3)15(22)19-12-5-6-13(16)18-11(12)2/h5-7,9H,4,8,10H2,1-3H3,(H,19,22) |
| InChIKey | FFKHNJJKMMWENE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|