C14H19N5O2 — CID 118788930
1-[(1-methylimidazol-2-yl)methyl]-3-(2-oxo-1H-pyridin-3-yl)-1-propylurea (PubChem CID 118788930) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 1-[(1-methylimidazol-2-yl)methyl]-3-(2-oxo-1H-pyridin-3-yl)-1-propylurea.
| Compound Name | 1-[(1-methylimidazol-2-yl)methyl]-3-(2-oxo-1H-pyridin-3-yl)-1-propylurea |
|---|---|
| PubChem CID | 118788930 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-[(1-methylimidazol-2-yl)methyl]-3-(2-oxo-1H-pyridin-3-yl)-1-propylurea |
| SMILES | CCCN(Cc1nccn1C)C(=O)Nc1ccc[nH]c1=O |
| InChI | InChI=1S/C14H19N5O2/c1-3-8-19(10-12-15-7-9-18(12)2)14(21)17-11-5-4-6-16-13(11)20/h4-7,9H,3,8,10H2,1-2H3,(H,16,20)(H,17,21) |
| InChIKey | GCFWCFGKKDFNON-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |