C14H23N3OS — CID 116509693
1-(3-ethoxypropyl)-3-[(3-ethyl-2-pyridinyl)methyl]thiourea (PubChem CID 116509693) has the molecular formula C14H23N3OS and a molecular weight of 281.42 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-[(3-ethyl-2-pyridinyl)methyl]thiourea.
| Compound Name | 1-(3-ethoxypropyl)-3-[(3-ethyl-2-pyridinyl)methyl]thiourea |
|---|---|
| PubChem CID | 116509693 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-[(3-ethyl-2-pyridinyl)methyl]thiourea |
| SMILES | CCOCCCNC(=S)NCc1ncccc1CC |
| InChI | InChI=1S/C14H23N3OS/c1-3-12-7-5-8-15-13(12)11-17-14(19)16-9-6-10-18-4-2/h5,7-8H,3-4,6,9-11H2,1-2H3,(H2,16,17,19) |
| InChIKey | BSSZOGVZRGVHAO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|