C12H19N3OS — CID 116508775
3-(3-ethoxypropyl)-1-methyl-1-pyridin-3-ylthiourea (PubChem CID 116508775) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 3-(3-ethoxypropyl)-1-methyl-1-pyridin-3-ylthiourea.
| Compound Name | 3-(3-ethoxypropyl)-1-methyl-1-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 116508775 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 3-(3-ethoxypropyl)-1-methyl-1-pyridin-3-ylthiourea |
| SMILES | CCOCCCNC(=S)N(C)c1cccnc1 |
| InChI | InChI=1S/C12H19N3OS/c1-3-16-9-5-8-14-12(17)15(2)11-6-4-7-13-10-11/h4,6-7,10H,3,5,8-9H2,1-2H3,(H,14,17) |
| InChIKey | KFFDSLRLGSXJDN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|