C13H19FN2OS — CID 115701705
3-(3-ethoxypropyl)-1-(3-fluorophenyl)-1-methylthiourea (PubChem CID 115701705) has the molecular formula C13H19FN2OS and a molecular weight of 270.37 g/mol. Its IUPAC name is 3-(3-ethoxypropyl)-1-(3-fluorophenyl)-1-methylthiourea.
| Compound Name | 3-(3-ethoxypropyl)-1-(3-fluorophenyl)-1-methylthiourea |
|---|---|
| PubChem CID | 115701705 |
| Molecular Formula | C13H19FN2OS |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 3-(3-ethoxypropyl)-1-(3-fluorophenyl)-1-methylthiourea |
| SMILES | CCOCCCNC(=S)N(C)c1cccc(F)c1 |
| InChI | InChI=1S/C13H19FN2OS/c1-3-17-9-5-8-15-13(18)16(2)12-7-4-6-11(14)10-12/h4,6-7,10H,3,5,8-9H2,1-2H3,(H,15,18) |
| InChIKey | MANDEDZFAPGMNK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|