C12H19ClN2OS2 — CID 113218506
1-[(5-chlorothiophen-2-yl)methyl]-3-(3-ethoxypropyl)-1-methylthiourea (PubChem CID 113218506) has the molecular formula C12H19ClN2OS2 and a molecular weight of 306.88 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-3-(3-ethoxypropyl)-1-methylthiourea.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-3-(3-ethoxypropyl)-1-methylthiourea |
|---|---|
| PubChem CID | 113218506 |
| Molecular Formula | C12H19ClN2OS2 |
| Molecular Weight | 306.88 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-3-(3-ethoxypropyl)-1-methylthiourea |
| SMILES | CCOCCCNC(=S)N(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H19ClN2OS2/c1-3-16-8-4-7-14-12(17)15(2)9-10-5-6-11(13)18-10/h5-6H,3-4,7-9H2,1-2H3,(H,14,17) |
| InChIKey | PBRHEZLSROAIAY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.88 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|