C15H26ClN3OS — CID 111239733
1-(3-butoxypropyl)-3-[2-(5-chlorothiophen-2-yl)ethyl]-2-methylguanidine (PubChem CID 111239733) has the molecular formula C15H26ClN3OS and a molecular weight of 331.91 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-3-[2-(5-chlorothiophen-2-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-(3-butoxypropyl)-3-[2-(5-chlorothiophen-2-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111239733 |
| Molecular Formula | C15H26ClN3OS |
| Molecular Weight | 331.91 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 1-(3-butoxypropyl)-3-[2-(5-chlorothiophen-2-yl)ethyl]-2-methylguanidine |
| SMILES | CCCCOCCCN/C(=N\C)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C15H26ClN3OS/c1-3-4-11-20-12-5-9-18-15(17-2)19-10-8-13-6-7-14(16)21-13/h6-7H,3-5,8-12H2,1-2H3,(H2,17,18,19) |
| InChIKey | ZHNHDHSBCOTFRW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.91 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|