C13H18F2N2O2S — CID 115570269
1-[2-(difluoromethoxy)phenyl]-3-(3-ethoxypropyl)thiourea (PubChem CID 115570269) has the molecular formula C13H18F2N2O2S and a molecular weight of 304.36 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)phenyl]-3-(3-ethoxypropyl)thiourea.
| Compound Name | 1-[2-(difluoromethoxy)phenyl]-3-(3-ethoxypropyl)thiourea |
|---|---|
| PubChem CID | 115570269 |
| Molecular Formula | C13H18F2N2O2S |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 1-[2-(difluoromethoxy)phenyl]-3-(3-ethoxypropyl)thiourea |
| SMILES | CCOCCCNC(=S)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C13H18F2N2O2S/c1-2-18-9-5-8-16-13(20)17-10-6-3-4-7-11(10)19-12(14)15/h3-4,6-7,12H,2,5,8-9H2,1H3,(H2,16,17,20) |
| InChIKey | KDGCEWLGKVYTBI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|