C20H20F4IN5O — CID 111888898
2-[[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide (PubChem CID 111888898) has the molecular formula C20H20F4IN5O and a molecular weight of 549.31 g/mol. Its IUPAC name is 2-[[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111888898 |
| Molecular Formula | C20H20F4IN5O |
| Molecular Weight | 549.31 g/mol |
| Exact Mass | 549.06 |
| IUPAC Name | 2-[[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2cc(F)ccc12)NCC(=O)Nc1ccc(F)c(F)c1F.I |
| InChI | InChI=1S/C20H19F4N5O.HI/c1-25-20(26-7-6-11-9-27-16-8-12(21)2-3-13(11)16)28-10-17(30)29-15-5-4-14(22)18(23)19(15)24;/h2-5,8-9,27H,6-7,10H2,1H3,(H,29,30)(H2,25,26,28);1H |
| InChIKey | QTEBBWBJXILDOH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|