C19H27FIN5O — CID 111888530
N-cyclopropyl-4-[[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]butanamide;hydroiodide (PubChem CID 111888530) has the molecular formula C19H27FIN5O and a molecular weight of 487.36 g/mol. Its IUPAC name is N-cyclopropyl-4-[[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]butanamide;hydroiodide.
| Compound Name | N-cyclopropyl-4-[[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]butanamide;hydroiodide |
|---|---|
| PubChem CID | 111888530 |
| Molecular Formula | C19H27FIN5O |
| Molecular Weight | 487.36 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | N-cyclopropyl-4-[[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]butanamide;hydroiodide |
| SMILES | C/N=C(\NCCCC(=O)NC1CC1)NCCc1c[nH]c2cc(F)ccc12.I |
| InChI | InChI=1S/C19H26FN5O.HI/c1-21-19(22-9-2-3-18(26)25-15-5-6-15)23-10-8-13-12-24-17-11-14(20)4-7-16(13)17;/h4,7,11-12,15,24H,2-3,5-6,8-10H2,1H3,(H,25,26)(H2,21,22,23);1H |
| InChIKey | AWWMDKHCDXBXOG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|