C17H23F4IN4O — CID 111888750
1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide (PubChem CID 111888750) has the molecular formula C17H23F4IN4O and a molecular weight of 502.29 g/mol. Its IUPAC name is 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111888750 |
| Molecular Formula | C17H23F4IN4O |
| Molecular Weight | 502.29 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC(F)(F)F)NCCc1c[nH]c2cc(F)ccc12.I |
| InChI | InChI=1S/C17H22F4N4O.HI/c1-22-16(23-6-2-8-26-11-17(19,20)21)24-7-5-12-10-25-15-9-13(18)3-4-14(12)15;/h3-4,9-10,25H,2,5-8,11H2,1H3,(H2,22,23,24);1H |
| InChIKey | LMIIHVIRJHHKQM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|