C17H19BrFIN4S — CID 111887684
1-[(4-bromothiophen-2-yl)methyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111887684) has the molecular formula C17H19BrFIN4S and a molecular weight of 537.24 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111887684 |
| Molecular Formula | C17H19BrFIN4S |
| Molecular Weight | 537.24 g/mol |
| Exact Mass | 535.95 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2cc(F)ccc12)NCc1cc(Br)cs1.I |
| InChI | InChI=1S/C17H18BrFN4S.HI/c1-20-17(23-9-14-6-12(18)10-24-14)21-5-4-11-8-22-16-7-13(19)2-3-15(11)16;/h2-3,6-8,10,22H,4-5,9H2,1H3,(H2,20,21,23);1H |
| InChIKey | JENFETKMUPTRKG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.24 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|