C20H24F3IN4O — CID 111282866
2-[[N-[(4-ethylphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide (PubChem CID 111282866) has the molecular formula C20H24F3IN4O and a molecular weight of 520.34 g/mol. Its IUPAC name is 2-[[N-[(4-ethylphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-[(4-ethylphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111282866 |
| Molecular Formula | C20H24F3IN4O |
| Molecular Weight | 520.34 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | 2-[[N-[(4-ethylphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
| SMILES | CCc1ccc(CN(C)/C(=N\C)NCC(=O)Nc2ccc(F)c(F)c2F)cc1.I |
| InChI | InChI=1S/C20H23F3N4O.HI/c1-4-13-5-7-14(8-6-13)12-27(3)20(24-2)25-11-17(28)26-16-10-9-15(21)18(22)19(16)23;/h5-10H,4,11-12H2,1-3H3,(H,24,25)(H,26,28);1H |
| InChIKey | UXUUFTKWIBHDGS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|