C19H22F3IN4O — CID 111288954
2-[[N,N'-dimethyl-N-[(4-methylphenyl)methyl]carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide (PubChem CID 111288954) has the molecular formula C19H22F3IN4O and a molecular weight of 506.31 g/mol. Its IUPAC name is 2-[[N,N'-dimethyl-N-[(4-methylphenyl)methyl]carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[N,N'-dimethyl-N-[(4-methylphenyl)methyl]carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111288954 |
| Molecular Formula | C19H22F3IN4O |
| Molecular Weight | 506.31 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | 2-[[N,N'-dimethyl-N-[(4-methylphenyl)methyl]carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
| SMILES | C/N=C(/NCC(=O)Nc1ccc(F)c(F)c1F)N(C)Cc1ccc(C)cc1.I |
| InChI | InChI=1S/C19H21F3N4O.HI/c1-12-4-6-13(7-5-12)11-26(3)19(23-2)24-10-16(27)25-15-9-8-14(20)17(21)18(15)22;/h4-9H,10-11H2,1-3H3,(H,23,24)(H,25,27);1H |
| InChIKey | VVIFWKGVJYHCNX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|