C18H25F3N4O — CID 109484093
2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 109484093) has the molecular formula C18H25F3N4O and a molecular weight of 370.42 g/mol. Its IUPAC name is 2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 109484093 |
| Molecular Formula | C18H25F3N4O |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H25F3N4O/c1-4-5-6-7-8-11-25(3)18(22-2)23-12-15(26)24-14-10-9-13(19)16(20)17(14)21/h4,9-10H,1,5-8,11-12H2,2-3H3,(H,22,23)(H,24,26) |
| InChIKey | LCAOFUOBQRHYLO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|