C9H7F4NO3 — CID 175536008
[2-fluoro-4-methyl-5-(trifluoromethoxy)phenyl]carbamic acid (PubChem CID 175536008) has the molecular formula C9H7F4NO3 and a molecular weight of 253.15 g/mol. Its IUPAC name is [2-fluoro-4-methyl-5-(trifluoromethoxy)phenyl]carbamic acid.
| Compound Name | [2-fluoro-4-methyl-5-(trifluoromethoxy)phenyl]carbamic acid |
|---|---|
| PubChem CID | 175536008 |
| Molecular Formula | C9H7F4NO3 |
| Molecular Weight | 253.15 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | [2-fluoro-4-methyl-5-(trifluoromethoxy)phenyl]carbamic acid |
| SMILES | Cc1cc(F)c(NC(=O)O)cc1OC(F)(F)F |
| InChI | InChI=1S/C9H7F4NO3/c1-4-2-5(10)6(14-8(15)16)3-7(4)17-9(11,12)13/h2-3,14H,1H3,(H,15,16) |
| InChIKey | ICWLZCNWXVPBAQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.15 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |