C10H13N3O6S — CID 61202066
2-hydroxy-4-(2-sulfamoylethylcarbamoylamino)benzoic acid (PubChem CID 61202066) has the molecular formula C10H13N3O6S and a molecular weight of 303.30 g/mol. Its IUPAC name is 2-hydroxy-4-(2-sulfamoylethylcarbamoylamino)benzoic acid.
| Compound Name | 2-hydroxy-4-(2-sulfamoylethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 61202066 |
| Molecular Formula | C10H13N3O6S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2-hydroxy-4-(2-sulfamoylethylcarbamoylamino)benzoic acid |
| SMILES | NS(=O)(=O)CCNC(=O)Nc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C10H13N3O6S/c11-20(18,19)4-3-12-10(17)13-6-1-2-7(9(15)16)8(14)5-6/h1-2,5,14H,3-4H2,(H,15,16)(H2,11,18,19)(H2,12,13,17) |
| InChIKey | KPNYSMQQWKSQAJ-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |